CAS 104794-31-2

4-(1,3-Benzodioxol-5-yl)-2,5-dimethyl-3-furancarboxylic acid

Description:

4-(1,3-Benzodioxol-5-yl)-2,5-dimethyl-3-furancarboxylic acid, with CAS number 104794-31-2, is an organic compound characterized by its complex structure that includes a furan ring and a benzodioxole moiety. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential reactivity due to the presence of functional groups. It is likely to be a solid at room temperature, with solubility in organic solvents, reflecting its hydrophobic characteristics. The presence of the carboxylic acid group suggests it can participate in acid-base reactions and may form salts or esters. Additionally, the compound may exhibit biological activity, making it of interest in pharmaceutical research. Its unique structure could also contribute to specific interactions in biological systems, potentially leading to applications in drug development or as a chemical intermediate. Overall, this compound represents a blend of structural features that may confer diverse chemical reactivity and biological significance.

Formula: C₁₄H₁₂O₅

InChI: InChI=1S/C14H12O5/c1-7-12(13(14(15)16)8(2)19-7)9-3-4-10-11(5-9)18-6-17-10/h3-5H,6H2,1-2H3,(H,15,16)

InChI key: InChIKey=RSEINJSAVLFFNE-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C(=C(C)OC1C)C=2C=C3C(=CC2)OCO3

Synonyms:

• 4-(1,3-Benzodioxol-5-yl)-2,5-dimethyl-3-furancarboxylic acid
• 3-Furancarboxylic acid, 4-(1,3-benzodioxol-5-yl)-2,5-dimethyl-