CymitQuimica logo

CAS 104795-85-9

:

methyl 6-chloro-1-benzothiophene-2-carboxylate

Description:
Methyl 6-chloro-1-benzothiophene-2-carboxylate is a chemical compound characterized by its unique structure, which includes a benzothiophene ring system, a chlorine substituent, and a carboxylate ester functional group. This compound typically appears as a solid or liquid, depending on its purity and specific conditions. It is known for its potential applications in organic synthesis and medicinal chemistry, particularly in the development of pharmaceuticals due to the presence of the benzothiophene moiety, which is often associated with biological activity. The chlorine atom introduces additional reactivity and can influence the compound's electronic properties, making it a valuable intermediate in various chemical reactions. Methyl 6-chloro-1-benzothiophene-2-carboxylate is soluble in organic solvents, and its reactivity can be modulated through various chemical transformations, allowing for the synthesis of more complex molecules. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C10H7ClO2S
InChI:InChI=1/C10H7ClO2S/c1-13-10(12)9-4-6-2-3-7(11)5-8(6)14-9/h2-5H,1H3
InChI key:YKNFICOVOXVEIN-UHFFFAOYSA-N
SMILES:COC(=O)c1cc2ccc(cc2s1)Cl
Synonyms:
  • Benzo[B]Thiophene-2-Carboxylic Acid, 6-Chloro-, Methyl Ester
  • Methyl 6-chlorobenzo[b]thiophene-2-carboxylate
  • Methyl-6-chlor-1-benzothiophen-2-carboxylat
Found 4 products.