CymitQuimica logo

CAS 104796-24-9

:

methyl 3-methoxy-2-(2-methoxy-2-oxoethoxy)benzoat

Description:
Methyl 3-methoxy-2-(2-methoxy-2-oxoethoxy)benzoate, with the CAS number 104796-24-9, is an organic compound characterized by its complex structure, which includes a benzoate moiety and multiple methoxy groups. This compound typically exhibits properties associated with esters, such as being a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is likely to be soluble in organic solvents due to the presence of methoxy groups, which enhance its polarity. The presence of the benzoate structure suggests potential applications in the synthesis of pharmaceuticals or agrochemicals, as well as in the development of fragrances or flavoring agents. Additionally, the compound may exhibit interesting biological activities, although specific data on its reactivity, stability, and toxicity would require further investigation. Overall, methyl 3-methoxy-2-(2-methoxy-2-oxoethoxy)benzoate represents a versatile chemical with potential utility in various fields of chemistry and industry.
Formula:C12H14O6
InChI:InChI=1/C12H14O6/c1-15-9-6-4-5-8(12(14)17-3)11(9)18-7-10(13)16-2/h4-6H,7H2,1-3H3
SMILES:COc1cccc(c1OCC(=O)OC)C(=O)OC
Synonyms:
  • Methyl 3-methoxy-2-(2-methoxy-2-oxoethoxy)benzoate
  • 3-methoxy-2-(2-methoxy-2-oxoethoxy)benzoic acid methyl ester
  • methyl 3-methoxy-2-(2-methoxy-2-oxoethoxy)benzoat
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.