
CAS 1048007-94-8
:N-(2-Methyl-5-nitrophenyl)-4-(3-pyridinyl)-2-thiazolamine
Description:
N-(2-Methyl-5-nitrophenyl)-4-(3-pyridinyl)-2-thiazolamine is a chemical compound characterized by its complex structure, which includes a thiazole ring, a nitrophenyl group, and a pyridine moiety. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity, which may be of interest in pharmaceutical research. The presence of the nitro group suggests that it may participate in electrophilic reactions, while the thiazole and pyridine rings can contribute to its ability to form coordination complexes with metal ions. Additionally, the compound may exhibit various biological activities, making it a candidate for further investigation in medicinal chemistry. Its molecular interactions and stability can be influenced by factors such as pH and solvent polarity. Overall, N-(2-Methyl-5-nitrophenyl)-4-(3-pyridinyl)-2-thiazolamine represents a class of compounds that may have applications in drug development and other chemical research fields.
Formula:C15H12N4O2S
InChI:InChI=1S/C15H12N4O2S/c1-10-4-5-12(19(20)21)7-13(10)17-15-18-14(9-22-15)11-3-2-6-16-8-11/h2-9H,1H3,(H,17,18)
InChI key:InChIKey=SDDODIFTQFSODB-UHFFFAOYSA-N
SMILES:N(C1=NC(=CS1)C=2C=CC=NC2)C3=CC(N(=O)=O)=CC=C3C
Synonyms:- 2-Thiazolamine, N-(2-methyl-5-nitrophenyl)-4-(3-pyridinyl)-
- N-(2-Methyl-5-nitrophenyl)-4-(3-pyridinyl)-2-thiazolamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.