
CAS 1048025-61-1
:4-Chloro-2,6-diiodobenzoic acid
Description:
4-Chloro-2,6-diiodobenzoic acid is an aromatic carboxylic acid characterized by the presence of a benzoic acid structure substituted with chlorine and iodine atoms. Specifically, it features a chlorine atom at the para position (4-position) and two iodine atoms at the ortho positions (2 and 6 positions) of the benzene ring. This compound is typically a solid at room temperature and may exhibit a crystalline structure. It is known for its potential applications in organic synthesis and as an intermediate in the production of pharmaceuticals or agrochemicals. The presence of halogen substituents can significantly influence its reactivity, solubility, and biological activity. Additionally, the compound may exhibit unique properties such as increased lipophilicity due to the halogen atoms, which can affect its interaction with biological systems. Safety data should be consulted for handling and disposal, as halogenated compounds can pose environmental and health risks.
Formula:C7H3ClI2O2
InChI:InChI=1S/C7H3ClI2O2/c8-3-1-4(9)6(7(11)12)5(10)2-3/h1-2H,(H,11,12)
InChI key:InChIKey=MAIAKPXUTVUMHR-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(I)C=C(Cl)C=C1I
Synonyms:- Benzoic acid, 4-chloro-2,6-diiodo-
- 4-Chloro-2,6-diiodobenzoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.