CAS 1048030-50-7

Borate(1-), [6-(1,3-dioxolan-2-yl)-2-pyridinyl]tris(2-propanolato)-, lithium (1:1), (T-4)-

Description:

The chemical substance known as Borate(1-), [6-(1,3-dioxolan-2-yl)-2-pyridinyl]tris(2-propanolato)-, lithium (1:1), (T-4)-, with CAS number 1048030-50-7, is a complex borate compound featuring a lithium cation and a borate anion. Its structure includes a pyridine ring substituted with a dioxolane moiety, which contributes to its potential solubility and reactivity. The presence of three 2-propanolato groups indicates that it has multiple alcohol functionalities, which can participate in hydrogen bonding and coordination chemistry. This compound may exhibit unique properties such as enhanced stability, solubility in organic solvents, and potential applications in catalysis or as a reagent in organic synthesis. The specific interactions and reactivity of this compound would depend on its molecular structure and the nature of the substituents, making it of interest in various fields, including materials science and medicinal chemistry. Further characterization through techniques such as NMR, IR spectroscopy, and mass spectrometry would provide more insights into its properties and potential applications.

Formula: C₁₇H₂₉BNO₅·Li

InChI: InChI=1S/C17H29BNO5.Li/c1-12(2)22-18(23-13(3)4,24-14(5)6)16-9-7-8-15(19-16)17-20-10-11-21-17;/h7-9,12-14,17H,10-11H2,1-6H3;/q-1;+1

InChI key: InChIKey=GBWGLJYVSBVHEX-UHFFFAOYSA-N

SMILES: [B+3]([O-]C(C)C)([O-]C(C)C)([O-]C(C)C)[C-]=1N=C(C=CC1)C2OCCO2.[Li+]

Synonyms:

• Borate(1-), [6-(1,3-dioxolan-2-yl)-2-pyridinyl]tris(2-propanolato)-, lithium (1:1), (T-4)-