CAS 104807-46-7
:methoctramine tetrahydrochloride hemihydrate
Description:
Methoctramine tetrahydrochloride hemihydrate is a chemical compound primarily recognized for its role as a selective antagonist of certain receptors in the body, particularly the muscarinic acetylcholine receptors. It is characterized by its tetrahydrochloride salt form, which indicates the presence of four chloride ions associated with the methoctramine molecule. The hemihydrate designation suggests that the compound contains half a molecule of water for every molecule of methoctramine tetrahydrochloride, influencing its physical properties such as solubility and stability. This compound is typically encountered in a crystalline form and is soluble in water, making it suitable for various pharmaceutical applications. Its pharmacological profile includes potential uses in treating conditions related to the autonomic nervous system. As with many chemical substances, handling methoctramine tetrahydrochloride hemihydrate requires adherence to safety protocols due to its biological activity and potential effects on human health.
Formula:C36H62N4O2·4ClH·H2O
InChI:InChI=1/C36H62N4O2.4ClH/c1-41-35-23-13-11-21-33(35)31-39-29-19-9-7-17-27-37-25-15-5-3-4-6-16-26-38-28-18-8-10-20-30-40-32-34-22-12-14-24-36(34)42-2;;;;/h11-14,21-24,37-40H,3-10,15-20,25-32H2,1-2H3;4*1H
InChI key:InChIKey=CDKGGOUDHGSFAF-UHFFFAOYSA-N
SMILES:C(NCCCCCCNCCCCCCCCNCCCCCCNCC1=C(OC)C=CC=C1)C2=C(OC)C=CC=C2.Cl
Synonyms:- 1,8-Octanediamine, N,N′-bis[6-[[(2-methoxyphenyl)methyl]amino]hexyl]-, tetrahydrochloride
- 1,8-Octanediamine, N<sup>1</sup>,N<sup>8</sup>-bis[6-[[(2-methoxyphenyl)methyl]amino]hexyl]-, hydrochloride (1:4)
- Methoctramine
- Methoctramine Hemihydrate
- Methoctramine hemihydrate tetrahydrochloride, N,Nμ-bis[6-[[(2-Methoxyphenyl)methyl]amino]hexyl]-1,8-octane diamine hemihydrate tetrahydrochloride
- N,N'-bis{6-[(2-methoxybenzyl)amino]hexyl}octane-1,8-diamine tetrahydrochloride
- 1,8-Octanediamine, N1,N8-bis[6-[[(2-methoxyphenyl)methyl]amino]hexyl]-, hydrochloride (1:4)
- methoctramine tetrahydrochloride hemihydrate
- Methoctramine tetrahydrochloride hydrate
- N,N′-bis[6-[[(2-Methoxyphenyl)methyl]amino]hexyl]-1,8-octane diamine tetrahydrochloride hydrate
- MethoctraMine hydrate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Methoctramine hydrate
CAS:Methoctramine hydrate is a cholinergic agent that is structurally related to bethanechol. It has been shown to bind to muscarinic receptors and inhibit voltage-dependent calcium channels, leading to neuronal death. Methoctramine hydrate causes an increase in cytosolic calcium concentration by inhibition of the sodium-calcium exchanger and activation of the inositol triphosphate receptor. The drug has also been shown to be effective against bowel disease, with a polymerase chain reaction test showing that it inhibits the replication of bacteria in the gut.
Methoctramine hydrate can also cause adverse effects such as increased heart rate, blurred vision, and urinary retention.Formula:C36H62N4O2·4HCl·xH2OPurity:Min. 95%Molecular weight:582.9 g/mol

