CymitQuimica logo

CAS 104809-08-7

:

2'-O-monosuccinyl-adenosine 3':5'-*cyclic monopho

Description:
2'-O-Monosuccinyl-adenosine 3':5'-cyclic monophosphate, commonly referred to as 2'-O-monosuccinyl-cAMP, is a derivative of adenosine cyclic monophosphate (cAMP) that features a succinyl group at the 2' position of the ribose sugar. This modification enhances its stability and alters its biological activity compared to standard cAMP. The compound is characterized by its cyclic structure, which is crucial for its role as a secondary messenger in various cellular processes. It typically exhibits increased resistance to hydrolysis, making it a useful tool in biochemical research for studying signal transduction pathways. The presence of the succinyl group can influence its interaction with specific receptors and enzymes, potentially leading to altered physiological effects. As a research chemical, it is often utilized in studies related to cell signaling, metabolism, and pharmacology, providing insights into the mechanisms of action of cAMP-related pathways. Its CAS number, 104809-08-7, is a unique identifier that facilitates its identification in chemical databases and literature.
Formula:C24H27N6O11P
InChI:InChI=1/C24H27N6O11P/c1-36-24(33)14(25)8-12-2-4-13(5-3-12)38-16(31)6-7-17(32)40-20-19-15(9-37-42(34,35)41-19)39-23(20)30-11-29-18-21(26)27-10-28-22(18)30/h2-5,10-11,14-15,19-20,23H,6-9,25H2,1H3,(H,34,35)(H2,26,27,28)
SMILES:COC(=O)C(Cc1ccc(cc1)OC(=O)CCC(=O)OC1C2C(COP(=O)(O)O2)OC1n1cnc2c(N)ncnc12)N
Synonyms:
  • 4-(2-amino-3-methoxy-3-oxopropyl)phenyl 6-(6-amino-9H-purin-9-yl)-2-hydroxy-2-oxidotetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-7-yl butanedioate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.