CAS 10481-34-2

2-Bromo-2-cyclopenten-1-one

Description:

2-Bromo-2-cyclopenten-1-one is an organic compound characterized by its unique structure, which includes a cyclopentene ring and a bromine substituent. It features a carbonyl group (C=O) adjacent to the bromine atom, contributing to its reactivity. This compound is typically a colorless to pale yellow liquid and is known for its distinctive odor. It is soluble in organic solvents such as ethanol and ether but has limited solubility in water due to its hydrophobic cyclopentene structure. The presence of the bromine atom makes it a potential electrophile, allowing it to participate in various chemical reactions, including nucleophilic substitutions and additions. Additionally, the compound may exhibit interesting biological activities, making it a subject of interest in medicinal chemistry. Safety precautions should be taken when handling this substance, as it may pose health risks due to its reactive nature and potential toxicity. Overall, 2-Bromo-2-cyclopenten-1-one is a valuable compound in organic synthesis and research applications.

Formula: C₅H₅BrO

InChI: InChI=1S/C5H5BrO/c6-4-2-1-3-5(4)7/h2H,1,3H2

InChI key: InChIKey=WJZDXONSAPNKGB-UHFFFAOYSA-N

SMILES: BrC=1C(=O)CCC1

Synonyms:

• 2-Bromo-2-cyclopenten-1-one
• 2-Bromocyclopent-2-En-1-One
• 2-Cyclopenten-1-one, 2-bromo-
• 2-Bromo-2-cyclopentenone

2-Bromo-2-cyclopentenone

CAS: 10481-34-2

Formula: C₅H₅BrO

Purity: 97%

Color and Shape: Solid

Molecular weight: 160.9966

Ref: IN-DA008TXQ

2-Bromocyclopent-2-en-1-one

CAS: 10481-34-2

2-Bromocyclopent-2-en-1-one

Purity: 97%

Color and Shape: Solid

Molecular weight: 161.00g/mol

Ref: 54-OR19566

2-Bromocyclopent-2-en-1-one

CAS: 10481-34-2

2-Bromocyclopent-2-en-1-one is a synthetic bidentate ligand with the formula CHClBr. It has been used in organic synthesis as a nucleophilic reagent. 2-Bromocyclopent-2-en-1-one is also an active methylene group, which can undergo substitution reactions to form cationic intermediates. The chloride and hydroxy groups on the molecule are stereoselective, allowing for two different orientation of the substituents on the same carbon atom. This class of compounds encompasses many antimicrobial agents, such as chlorhexidine, hexachlorophene, and trichlorocarbanilide.

Formula: C₅H₅BrO

Purity: Min. 95%

Molecular weight: 161 g/mol

Ref: 3D-KAA48134