CAS 104821-25-2
:Dihydroethidium
Description:
Dihydroethidium (DHE) is a fluorescent compound commonly used in biological and chemical research, particularly for detecting reactive oxygen species (ROS) in live cells. It is a derivative of ethidium bromide and is known for its ability to penetrate cell membranes and undergo oxidation in the presence of superoxide anions, resulting in a fluorescent product that can be quantified. DHE is characterized by its relatively low toxicity, making it suitable for in vivo studies. The fluorescence emitted by the oxidized form of DHE can be measured using fluorescence microscopy or flow cytometry, allowing researchers to assess oxidative stress levels in various biological systems. Additionally, DHE is often employed in studies related to cellular signaling, apoptosis, and inflammation. Its chemical structure includes a planar aromatic system, which contributes to its fluorescent properties, and it is typically used in concentrations that ensure effective detection without compromising cell viability. Overall, Dihydroethidium serves as a valuable tool in the field of cellular biology and oxidative stress research.
Formula:C21H21N3
InChI:InChI=1S/C21H21N3/c1-2-24-20-13-16(23)9-11-18(20)17-10-8-15(22)12-19(17)21(24)14-6-4-3-5-7-14/h3-13,21H,2,22-23H2,1H3
InChI key:InChIKey=XYJODUBPWNZLML-UHFFFAOYSA-N
SMILES:C(C)N1C(C=2C(C=3C1=CC(N)=CC3)=CC=C(N)C2)C4=CC=CC=C4
Synonyms:- Hydroethidine
- 3,8-Phenanthridinediamine, 5-ethyl-5,6-dihydro-6-phenyl-
- 5-Ethyl-5,6-dihydro-6-phenyl-3,8-phenanthridinediamine
- PD-MY 003
- 3,8-Phenanthridinediamine, 5-ethyl-5,6-dihydro-6-phenyl-, (±)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
Dihydroethidium
CAS:Formula:C21H21N3Purity:≥ 95.0%Color and Shape:Pink, red or dark red powderMolecular weight:315.41Dihydroethidium
CAS:Dihydroethidium (PD-MY 003) is a peroxide indicator with blue fluorescence in the cytoplasm (λex=518 nm, λem=616 nm). Cost-effective and quality-assured.Formula:C21H21N3Purity:99.52% - 99.91%Color and Shape:Pink To Purple Fine Crystalline PowderMolecular weight:315.41Ref: TM-T2021
5mg35.00€10mg57.00€25mg93.00€50mg123.00€100mg173.00€200mg259.00€500mg442.00€1mL*10mM (DMSO)47.00€Dihydroethidium
CAS:Dihydroethidium is a fluorescent probe that has been used to study the effects of reactive oxygen species on the mitochondrial membrane potential. It also acts as a cyclase inhibitor, preventing the formation of cAMP and cGMP. Dihydroethidium has been shown to be an effective chemoattractant in a model system for myocardial infarct and atherosclerotic lesions. This agent is capable of inducing pluripotent cells into cardiomyocyte-like cells. Dihydroethidium is not toxic to healthy cells and is relatively nontoxic to animals. It has been shown to have antioxidative properties, which may be due to its ability to scavenge superoxide radicals.Formula:C21H21N3Purity:Min. 95%Molecular weight:315.41 g/mol






