CAS 104830-01-5
:ETHYL 3-(2-AMINOPYRIDIN-3-YL)ACRYLATE
Description:
Ethyl 3-(2-aminopyridin-3-yl)acrylate, identified by the CAS number 104830-01-5, is an organic compound characterized by its structure, which includes an ethyl ester group and a pyridine derivative. This compound features a double bond in the acrylate moiety, making it a potential candidate for polymerization reactions. The presence of the amino group on the pyridine ring suggests that it may exhibit basic properties and can participate in various chemical reactions, such as nucleophilic substitutions or coupling reactions. Ethyl 3-(2-aminopyridin-3-yl)acrylate may also display biological activity, potentially serving as a building block in the synthesis of pharmaceuticals or agrochemicals. Its solubility in organic solvents and moderate reactivity make it useful in organic synthesis. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken. Overall, this compound's unique functional groups and structural features contribute to its versatility in chemical applications.
Formula:C10H12N2O2
InChI:InChI=1/C10H12N2O2/c1-2-14-9(13)6-5-8-4-3-7-12-10(8)11/h3-7H,2H2,1H3,(H2,11,12)
SMILES:CCOC(=O)C=Cc1cccnc1N
Synonyms:- Ethyl 3-(2-amino-3-pyridyl)acrylate
- Ethyl 3-(2-Amino-3-Pyridyl)Prop-2-Enoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
