CAS 104830-07-1
:3-(4-AMINO-PYRIDIN-3-YL)-ACRYLIC ACID ETHYL ESTER
Description:
3-(4-Amino-pyridin-3-yl)-acrylic acid ethyl ester, identified by its CAS number 104830-07-1, is an organic compound characterized by the presence of both an amino group and an ester functional group. This compound features a pyridine ring, which contributes to its aromatic properties and potential biological activity. The acrylic acid moiety provides a double bond that can participate in various chemical reactions, such as polymerization or conjugation with other molecules. The ethyl ester group enhances its solubility in organic solvents, making it suitable for various applications in organic synthesis and medicinal chemistry. Additionally, the amino group may impart basicity and facilitate interactions with biological targets, suggesting potential roles in pharmaceuticals or agrochemicals. Overall, this compound's structure indicates versatility in reactivity and potential utility in diverse chemical contexts.
Formula:C10H12N2O2
InChI:InChI=1/C10H12N2O2/c1-2-14-10(13)4-3-8-7-12-6-5-9(8)11/h3-7H,2H2,1H3,(H2,11,12)
SMILES:CCOC(=O)C=Cc1c[nH]ccc1=N
Synonyms:- Ethyl 3-(4-Aminopyridin-3-Yl)Acrylate
- Ethyl 3-(4-amino-3-pyridyl)acrylate
- Ethyl 3-(4-Amino-3-Pyridyl)Prop-2-Enoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
