CymitQuimica logo

CAS 1048330-10-4

:

(3-(Methoxycarbonyl)-4-methylphenyl)boronic acid

Description:
(3-(Methoxycarbonyl)-4-methylphenyl)boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols, making it useful in various chemical reactions, particularly in Suzuki coupling reactions. This compound features a methoxycarbonyl group, which contributes to its reactivity and solubility properties, as well as a methyl group that can influence its steric and electronic characteristics. The presence of the aromatic ring enhances its stability and can affect its interaction with other molecules. Typically, boronic acids are utilized in organic synthesis, medicinal chemistry, and materials science due to their versatility. The compound's solubility in organic solvents and its ability to participate in cross-coupling reactions make it valuable in the development of pharmaceuticals and agrochemicals. Additionally, its structural features may allow for specific interactions in biological systems, warranting further investigation into its potential applications in drug discovery and development.
Formula:C9H11BO4
InChI:InChI=1S/C9H11BO4/c1-6-3-4-7(10(12)13)5-8(6)9(11)14-2/h3-5,12-13H,1-2H3
InChI key:CDWTTYCJDYKRNE-UHFFFAOYSA-N
SMILES:B(C1=CC(=C(C=C1)C)C(=O)OC)(O)O
Found 4 products.