CAS 1048330-63-7
:4-(6-Methoxy-3-pyridinyl)-3-pyrrolidinecarboxylic acid
Description:
4-(6-Methoxy-3-pyridinyl)-3-pyrrolidinecarboxylic acid, identified by its CAS number 1048330-63-7, is a chemical compound characterized by its unique structural features, which include a pyridine ring and a pyrrolidine moiety. This compound typically exhibits properties associated with both heterocyclic compounds and carboxylic acids, such as solubility in polar solvents and potential for forming hydrogen bonds due to the presence of the carboxylic acid functional group. The methoxy group on the pyridine ring can influence its electronic properties, potentially enhancing its reactivity and interactions in biological systems. This compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural similarity to biologically active molecules. Additionally, its specific stereochemistry and functional groups may contribute to its pharmacological profile, making it a candidate for further research in drug design and development. As with many organic compounds, its stability, reactivity, and biological activity would depend on various factors, including environmental conditions and the presence of other chemical species.
Formula:C11H14N2O3
InChI:InChI=1S/C11H14N2O3/c1-16-10-3-2-7(4-13-10)8-5-12-6-9(8)11(14)15/h2-4,8-9,12H,5-6H2,1H3,(H,14,15)
InChI key:InChIKey=PJMXSRWOACCNPD-UHFFFAOYSA-N
SMILES:C(O)(=O)C1C(CNC1)C=2C=CC(OC)=NC2
Synonyms:- 4-(6-Methoxy-3-pyridinyl)-3-pyrrolidinecarboxylic acid
- 3-Pyrrolidinecarboxylic acid, 4-(6-methoxy-3-pyridinyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.