CAS 1048343-57-2

1H-Indole-3-ethanamine, 2,7-dimethyl-, ethanedioate (1:1)

Description:

1H-Indole-3-ethanamine, 2,7-dimethyl-, ethanedioate (1:1), with CAS number 1048343-57-2, is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This specific compound features a 2,7-dimethyl substitution on the indole ring, enhancing its biological activity and potentially influencing its pharmacological properties. The presence of the ethanamine group suggests it may exhibit amine-like reactivity, while the ethanedioate component indicates the formation of a salt or complex with ethanoic acid, which can affect solubility and stability. Such compounds are often studied for their potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting neurological or psychiatric conditions. The molecular interactions, including hydrogen bonding and hydrophobic effects, play a crucial role in its biological activity. Overall, this compound's unique structural features contribute to its potential utility in various chemical and biological applications.

Formula: C₁₂H₁₆N₂·C₂H₂O₄

InChI: InChI=1S/C12H16N2.C2H2O4/c1-8-4-3-5-11-10(6-7-13)9(2)14-12(8)11;3-1(4)2(5)6/h3-5,14H,6-7,13H2,1-2H3;(H,3,4)(H,5,6)

InChI key: InChIKey=KGLPRFLCYRTDCT-UHFFFAOYSA-N

SMILES: C(CN)C=1C=2C(NC1C)=C(C)C=CC2.C(C(O)=O)(O)=O

Synonyms:

• 1H-Indole-3-ethanamine, 2,7-dimethyl-, ethanedioate (1:1)

2-(2,7-Dimethyl-1H-indol-3-yl)ethanamine oxalic acid

Controlled Product

CAS: 1048343-57-2

Please enquire for more information about 2-(2,7-Dimethyl-1H-indol-3-yl)ethanamine oxalic acid including the price, delivery time and more detailed product information at the technical inquiry form on this page

Formula: C₁₄H₁₈N₂O₄

Purity: Min. 95%

Molecular weight: 278.3 g/mol

Ref: 3D-YRB34357