
CAS 10484-03-4
:N-(2,4-Dinitrophenyl)leucine
Description:
N-(2,4-Dinitrophenyl)leucine is an organic compound characterized by the presence of a leucine amino acid moiety linked to a 2,4-dinitrophenyl group. This compound is typically used in biochemical research, particularly in studies involving protein synthesis and enzyme activity. The dinitrophenyl group serves as a chromophore, making it useful for spectrophotometric analysis. The presence of the amino acid leucine, which is a branched-chain amino acid, contributes to the compound's hydrophobic characteristics, influencing its solubility and interaction with biological membranes. N-(2,4-Dinitrophenyl)leucine can participate in various chemical reactions, including nucleophilic substitutions and coupling reactions, which are essential in peptide synthesis. Additionally, due to the presence of the dinitrophenyl group, this compound can exhibit strong absorbance in the ultraviolet-visible spectrum, making it valuable for analytical applications. Safety considerations should be taken into account when handling this compound, as dinitrophenyl derivatives can be hazardous and potentially toxic.
Formula:C12H15N3O6
InChI:InChI=1S/C12H15N3O6/c1-7(2)5-10(12(16)17)13-9-4-3-8(14(18)19)6-11(9)15(20)21/h3-4,6-7,10,13H,5H2,1-2H3,(H,16,17)
InChI key:InChIKey=STMDPCBYJCIZOD-UHFFFAOYSA-N
SMILES:N(C(CC(C)C)C(O)=O)C1=C(N(=O)=O)C=C(N(=O)=O)C=C1
Synonyms:- DL-Leucine, N-(2,4-dinitrophenyl)-
- 2,4-Dinitrophenyl-DL-leucine
- Leucine, N-(2,4-dinitrophenyl)-, DL-
- Leucine, N-(2,4-dinitrophenyl)-
- N-(2,4-Dinitrophenyl)leucine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.