CymitQuimica logo

CAS 10484-56-7

:

2-Butoxynaphthalene

Description:
2-Butoxynaphthalene, with the CAS number 10484-56-7, is an organic compound characterized by its naphthalene backbone substituted with a butoxy group at the second position. This compound typically appears as a colorless to pale yellow liquid with a distinctive aromatic odor. It is relatively hydrophobic, exhibiting low solubility in water but good solubility in organic solvents. 2-Butoxynaphthalene is known for its applications as a solvent and as an intermediate in the synthesis of various chemical products. Its molecular structure contributes to its chemical stability and reactivity, allowing it to participate in electrophilic aromatic substitution reactions. Additionally, it may exhibit moderate toxicity, necessitating proper handling and safety precautions during use. The compound's physical properties, such as boiling point and density, are influenced by its molecular weight and structure, making it relevant in both industrial and research settings. Overall, 2-Butoxynaphthalene serves as an important compound in organic chemistry and materials science.
Formula:C14H16O
InChI:InChI=1S/C14H16O/c1-2-3-10-15-14-9-8-12-6-4-5-7-13(12)11-14/h4-9,11H,2-3,10H2,1H3
InChI key:InChIKey=CDMIQAIIIBPTRK-UHFFFAOYSA-N
SMILES:O(CCCC)C1=CC2=C(C=C1)C=CC=C2
Synonyms:
  • 2-Butoxynaphthalene
  • Ai3-20476
  • Butyl β-naphthyl ether
  • Fragarol
  • Naphthalene, 2-butoxy-
  • β-Naphthol butyl ether
Found 6 products.