CymitQuimica logo

CAS 104840-34-8

:

bagougeramine B

Description:
Bagougeramine B is a naturally occurring alkaloid that has garnered interest due to its unique structural features and potential biological activities. It is characterized by a complex bicyclic structure that includes nitrogen atoms, which contribute to its pharmacological properties. The compound is typically isolated from specific plant sources and exhibits a range of biological activities, including antimicrobial and cytotoxic effects, making it a subject of research in medicinal chemistry. Its molecular formula and specific stereochemistry play crucial roles in its interaction with biological targets. Additionally, bagougeramine B may undergo various chemical transformations, influencing its stability and reactivity. As with many alkaloids, its solubility and behavior in different solvents can vary, impacting its extraction and purification processes. Ongoing studies aim to elucidate its mechanism of action and potential therapeutic applications, highlighting the importance of natural products in drug discovery and development.
Formula:C24H42N12O8
InChI:InChI=1/C24H44N12O7/c1-29-12-15(37)33-13(11-32-23(27)28)20(40)35-16-17(38)18(39)22(36-10-5-14(26)34-24(36)42)43-19(16)21(41)31-9-4-8-30-7-3-2-6-25/h5,10,13,16-19,22,29-30,38-39H,2-4,6-9,11-12,25H2,1H3,(H,31,41)(H,33,37)(H,35,40)(H2,26,34,42)(H4,27,28,32)/t13-,16+,17+,18-,19+,22-/m1/s1
Synonyms:
  • N-[3-[(4-Aminobutyl)amino]propyl]-4-[[3-[(aminoiminomethyl)amino]-N-(N-methylglycyl)-D-alanyl]amino]-1-(1,2-dihydro-4-amino-2-oxopyrimidin-1-yl)-1,4-dideoxy-β-D-glucopyranulonamide
  • beta-D-Glucopyranuronamide, N-(3-((4-aminobutyl)amino)propyl)-4-((3-((aminoiminomethyl)amino)-N-(N-methylglycyl)-D-alanyl)amino)-1-(4-amino-2-oxo-1(2H)-pyrimidinyl)-1,4-dideoxy-
  • bagougeramine B
  • Bagougeramine B
  • (2S,3S,4S,5R,6R)-N-{3-[(4-aminobutyl)amino]propyl}-6-(4-amino-2-oxopyrimidin-1(2H)-yl)-3-{[(2R)-3-[(diaminomethylidene)amino]-2-{[(methylamino)acetyl]amino}propanoyl]amino}-4,5-dihydroxytetrahydro-2H-pyran-2-carboxamide (non-preferred name)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
  • Bagougeramine B

    CAS:
    <p>Bagougeramine B is an orally active nucleoside antibiotic with antibacterial properties, discovered in Bacillus circulans. It inhibits the growth of both Gram-positive and Gram-negative bacteria, as well as some fungi.</p>
    Formula:C24H44N12O7
    Color and Shape:Solid
    Molecular weight:612.682