CAS 104846-75-5

Phosphine oxide, [2-[5-[[(1,1-dimethylethyl)dimethylsilyl]oxy]-2-methylenecyclohexylidene]ethyl]diphenyl-, (Z)-

Description:

Phosphine oxide, specifically the compound with the name "2-[5-[[(1,1-dimethylethyl)dimethylsilyl]oxy]-2-methylenecyclohexylidene]ethyl]diphenyl-, (Z)-" and CAS number 104846-75-5, is a specialized organophosphorus compound characterized by the presence of a phosphine oxide functional group. This compound features a complex structure that includes a phosphine oxide moiety, which is known for its stability and reactivity in various chemical reactions. The presence of the dimethylethylsilyl group suggests potential applications in materials science, particularly in the development of siloxane-based polymers or coatings. The (Z)-configuration indicates a specific stereochemistry that can influence the compound's reactivity and interactions with other molecules. Additionally, the diphenyl substituent contributes to the compound's overall hydrophobicity and may enhance its solubility in organic solvents. Overall, this compound is of interest in synthetic chemistry and materials development due to its unique structural features and potential applications in various fields.

Formula: C₂₇H₃₇O₂PSi

InChI: InChI=1/C27H37O2PSi/c1-22-17-18-24(29-31(5,6)27(2,3)4)21-23(22)19-20-30(28,25-13-9-7-10-14-25)26-15-11-8-12-16-26/h7-16,19,24H,1,17-18,20-21H2,2-6H3/b23-19-

InChI key: InChIKey=OFSDSMTXHBTJEI-NMWGTECJNA-N

SMILES: P(C/C=C\1/CC(O[Si](C(C)(C)C)(C)C)CCC1=C)(=O)(C2=CC=CC=C2)C3=CC=CC=C3

Synonyms:

• Phosphine oxide, [2-[5-[[(1,1-dimethylethyl)dimethylsilyl]oxy]-2-methylenecyclohexylidene]ethyl]diphenyl-, (Z)-