CAS 104857-48-9

4-(2-Oxiranylmethoxy)-benzeneethanol

Description:

4-(2-Oxiranylmethoxy)-benzeneethanol, also known by its CAS number 104857-48-9, is a chemical compound characterized by its unique structure that includes an epoxide group (oxirane) and a benzene ring with a hydroxyl (alcohol) functional group. This compound typically exhibits properties associated with both aromatic and aliphatic compounds, such as moderate polarity and potential reactivity due to the presence of the epoxide, which can participate in nucleophilic reactions. The hydroxyl group contributes to its solubility in polar solvents and may influence its hydrogen bonding capabilities. Additionally, the compound may exhibit biological activity, making it of interest in medicinal chemistry and materials science. Its synthesis and reactivity can be influenced by the specific conditions under which it is prepared, including temperature and the presence of catalysts. Overall, 4-(2-Oxiranylmethoxy)-benzeneethanol represents a versatile structure with potential applications in various chemical and pharmaceutical fields.

Formula: C₁₁H₁₄O₃

InChI: InChI=1/C11H14O3/c12-6-5-9-1-3-10(4-2-9)13-7-11-8-14-11/h1-4,11-12H,5-8H2

SMILES: c1cc(ccc1CCO)OCC1CO1

Synonyms:

• 4-(Oxiranylmethoxy)-benzeneethanol
• 2-[4-(Oxiran-2-Ylmethoxy)Phenyl]Ethanol
• Metoprolol Hydroxy Epoxide IMpurity
• 4-(2-Oxiranylmethoxy)-benzeneethanol

Metoprolol Impurity 15

CAS: 104857-48-9

Formula: C₁₁H₁₄O₃

Molecular weight: 194.23

Ref: 4Z-M-0843

4-(2-Oxiranylmethoxy)benzeneethanol

CAS: 104857-48-9

Formula: C₁₁H₁₄O₃

Molecular weight: 194.23

Ref: ST-EA-CP-M17022

4-(2-Oxiranylmethoxy)benzeneethanol

CAS: 104857-48-9

Please enquire for more information about 4-(2-Oxiranylmethoxy)benzeneethanol including the price, delivery time and more detailed product information at the technical inquiry form on this page

Formula: C₁₁H₁₄O₃

Purity: Min. 95%

Molecular weight: 194.23 g/mol

Ref: 3D-FO26633