CAS 104857-88-7
:methyl pentafluoropropionylacetate
Description:
Methyl pentafluoropropionylacetate, with the CAS number 104857-88-7, is an organic compound characterized by its unique structure that includes a methyl ester group and a pentafluoropropionyl moiety. This compound is notable for its high fluorine content, which imparts distinct chemical properties such as increased lipophilicity and thermal stability. The presence of multiple fluorine atoms often enhances the compound's reactivity and can influence its behavior in various chemical reactions, including nucleophilic substitutions and acylation processes. Methyl pentafluoropropionylacetate is typically used in specialized applications, including as a reagent in organic synthesis and in the development of fluorinated materials. Its physical properties, such as boiling point and solubility, are influenced by the fluorinated groups, making it a compound of interest in both academic research and industrial applications. Safety precautions should be observed when handling this substance due to its potential reactivity and the health hazards associated with fluorinated compounds.
Formula:C6H5F5O3
InChI:InChI=1/C6H5F5O3/c1-14-4(13)2-3(12)5(7,8)6(9,10)11/h2H2,1H3
SMILES:COC(=O)CC(=O)C(C(F)(F)F)(F)F
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Methyl pentafluoropropionylacetate
CAS:Methyl pentafluoropropionylacetatePurity:≥95%Color and Shape:LiquidMolecular weight:220.09g/molMethyl 4,4,5,5,5-Pentafluoro-3-Oxopentanoate
CAS:Methyl 4,4,5,5,5-Pentafluoro-3-Oxopentanoate is a fluorinated excipient that is used to produce stable and active pharmaceutical ingredients. It is an ether and a propellant. The molecule can be used as an anhydride in the synthesis of other chemical compounds. Methyl 4,4,5,5,5-Pentafluoro-3-Oxopentanoate is also used in the production of aerosol medications for inhalation therapy.Formula:C6H5F5O3Purity:Min. 95%Molecular weight:220.09 g/mol
