CymitQuimica logo

CAS 10486-42-7

:

1,3-Dihydro-2H-naphth[2,3-d]imidazole-2-thione

Description:
1,3-Dihydro-2H-naphth[2,3-d]imidazole-2-thione, with the CAS number 10486-42-7, is a heterocyclic compound characterized by its fused ring structure, which includes both naphthalene and imidazole moieties. This compound typically exhibits a thione functional group, which is a sulfur-containing analogue of a ketone. It is known for its potential biological activities, including antimicrobial and antifungal properties, making it of interest in medicinal chemistry. The presence of sulfur in its structure can influence its reactivity and solubility, often leading to unique interactions in biological systems. Additionally, the compound may exhibit fluorescence properties, which can be useful in various analytical applications. Its synthesis often involves multi-step organic reactions, and it may serve as a precursor for further chemical modifications. Overall, 1,3-Dihydro-2H-naphth[2,3-d]imidazole-2-thione represents a class of compounds that bridge organic chemistry and pharmacology, highlighting the importance of heterocycles in drug development.
Formula:C11H8N2S
InChI:InChI=1S/C11H8N2S/c14-11-12-9-5-7-3-1-2-4-8(7)6-10(9)13-11/h1-6H,(H2,12,13,14)
InChI key:InChIKey=DDPQKZFRVMYIQG-UHFFFAOYSA-N
SMILES:S=C1NC=2C(=CC=3C(C2)=CC=CC3)N1
Synonyms:
  • 1,3-Dihydro-2H-naphth[2,3-d]imidazole-2-thione
  • Naphth[2,3-d]imidazole-2-thiol
  • NSC 135810
  • 1H-Naphth[2,3-d]imidazole-2-thiol
  • 2H-Naphth[2,3-d]imidazole-2-thione, 1,3-dihydro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.