CAS 10486-54-1

5-({2-[(5-mercapto-1,3,4-thiadiazol-2-yl)thio]ethyl}thio)-1,3,4-thiadiazole-2-thiol

Description:

5-({2-[(5-mercapto-1,3,4-thiadiazol-2-yl)thio]ethyl}thio)-1,3,4-thiadiazole-2-thiol, with CAS number 10486-54-1, is a chemical compound characterized by its thiadiazole core structure, which is notable for its sulfur-containing heterocycles. This compound features multiple thiol (-SH) groups, contributing to its potential reactivity and ability to form disulfide bonds. The presence of the mercapto group enhances its nucleophilicity, making it useful in various chemical reactions, including those involving metal ions. Its structure suggests potential applications in medicinal chemistry, particularly in the development of antimicrobial or antifungal agents, due to the biological activity often associated with thiadiazole derivatives. Additionally, the compound may exhibit antioxidant properties, which can be beneficial in various biochemical applications. Overall, its unique structural features and functional groups make it a compound of interest in both synthetic and applied chemistry contexts.

Formula: C₆H₆N₄S₆

InChI: InChI=1/C6H6N4S6/c11-3-7-9-5(15-3)13-1-2-14-6-10-8-4(12)16-6/h1-2H2,(H,7,11)(H,8,12)

SMILES: C(CSc1nnc(S)s1)Sc1nnc(S)s1

Synonyms:

• 5,5'-(ethane-1,2-diyldisulfanediyl)bis(1,3,4-thiadiazole-2(3H)-thione)

1,4-Bis(5-mercapto-1,3,4-thiadiazole-2-ylthio)ethane

CAS: 10486-54-1

1,4-Bis(5-mercapto-1,3,4-thiadiazole-2-ylthio)ethane

Purity: ≥95%

Color and Shape: Solid

Molecular weight: 326.53g/mol

Ref: 54-OR1526