CAS 104864-10-0

1-Propanamine, 2-[(4-chlorophenyl)thio]-, hydrochloride (1:1)

Description:

1-Propanamine, 2-[(4-chlorophenyl)thio]-, hydrochloride (1:1), with the CAS number 104864-10-0, is a chemical compound characterized by its amine functional group and a thioether linkage. This substance features a propanamine backbone substituted with a 4-chlorophenylthio group, which contributes to its unique properties. As a hydrochloride salt, it is typically encountered in a solid form, enhancing its solubility in water and making it suitable for various applications in pharmaceutical and chemical research. The presence of the chlorine atom on the phenyl ring can influence the compound's reactivity and biological activity, potentially affecting its interaction with biological targets. Additionally, the amine group may participate in hydrogen bonding, impacting its physical properties such as melting point and solubility. Overall, this compound's structure suggests potential utility in medicinal chemistry, particularly in the development of therapeutic agents. However, specific safety and handling guidelines should be followed due to the presence of chlorine and the amine functionality.

Formula: C₉H₁₂ClNS·ClH

InChI: InChI=1S/C9H12ClNS.ClH/c1-7(6-11)12-9-4-2-8(10)3-5-9;/h2-5,7H,6,11H2,1H3;1H

InChI key: InChIKey=LRIDOGBWKAQAQC-UHFFFAOYSA-N

SMILES: S(C(CN)C)C1=CC=C(Cl)C=C1.Cl

Synonyms:

• 2-[(4-Chlorophenyl)sulfanyl]propan-1-amine hydrochloride
• 1-Propanamine, 2-[(4-chlorophenyl)thio]-, hydrochloride (1:1)
• 1-Propanamine, 2-[(4-chlorophenyl)thio]-, hydrochloride