CAS 104864-59-7

2-CHLORO-N-{2-[(4-CHLOROPHENYL)THIO]ETHYL}ACETAMIDE

Description:

2-Chloro-N-{2-[(4-chlorophenyl)thio]ethyl}acetamide is an organic compound characterized by its complex structure, which includes a chloro group, an acetamide functional group, and a thioether linkage. The presence of the chloro substituent indicates potential reactivity, particularly in nucleophilic substitution reactions. The thioether moiety contributes to the compound's overall polarity and can influence its solubility in various solvents. This compound may exhibit biological activity due to its structural features, making it of interest in pharmaceutical research. Its molecular structure suggests potential interactions with biological targets, which could be explored for therapeutic applications. Additionally, the presence of aromatic rings, such as the 4-chlorophenyl group, may enhance its stability and influence its electronic properties. Overall, 2-chloro-N-{2-[(4-chlorophenyl)thio]ethyl}acetamide is a compound with diverse chemical characteristics that can be leveraged in various chemical and biological contexts.

Formula: C₁₀H₁₁Cl₂NOS

InChI: InChI=1/C10H11Cl2NOS/c11-7-10(14)13-5-6-15-9-3-1-8(12)2-4-9/h1-4H,5-7H2,(H,13,14)

SMILES: c1cc(ccc1Cl)SCCN=C(CCl)O

Synonyms:

• acetamide, 2-chloro-N-[2-[(4-chlorophenyl)thio]ethyl]-
• 2-chloro-N-{2-[(4-chlorophenyl)sulfanyl]ethyl}acetamide
• 2-chloro-N-{2-[(4-chlorophenyl)thio]ethyl}acetamide

2-Chloro-N-{2-[(4-chlorophenyl)sulfanyl]ethyl}acetamide

CAS: 104864-59-7

Versatile small molecule scaffold

Formula: C₁₀H₁₁Cl₂NOS

Purity: Min. 95%

Molecular weight: 264.17 g/mol

Ref: 3D-EEA86459