CAS 1048640-53-4

Benzenemethanamine, N-[2-(1-cyclohexen-1-yl)ethyl]-4-fluoro-, hydrochloride (1:1)

Description:

Benzenemethanamine, N-[2-(1-cyclohexen-1-yl)ethyl]-4-fluoro-, hydrochloride (1:1), identified by the CAS number 1048640-53-4, is a chemical compound characterized by its amine functional group and a fluorinated aromatic structure. This compound features a cyclohexene moiety, which contributes to its unique reactivity and potential applications in organic synthesis and medicinal chemistry. The presence of the hydrochloride indicates that it exists as a salt, enhancing its solubility in polar solvents, which is beneficial for various laboratory applications. The fluorine atom in the para position of the benzene ring can influence the compound's electronic properties, potentially affecting its biological activity and interaction with receptors. As with many amines, it may exhibit basic properties, allowing it to participate in various chemical reactions, including nucleophilic substitutions. Safety and handling precautions should be observed due to the potential for toxicity and reactivity associated with amines and halogenated compounds. Further studies would be necessary to fully elucidate its pharmacological profile and potential uses in therapeutic contexts.

Formula: C₁₅H₂₀FN·ClH

InChI: InChI=1S/C15H20FN.ClH/c16-15-8-6-14(7-9-15)12-17-11-10-13-4-2-1-3-5-13;/h4,6-9,17H,1-3,5,10-12H2;1H

InChI key: InChIKey=LRSJDPDCQKZNFV-UHFFFAOYSA-N

SMILES: C(NCCC=1CCCCC1)C2=CC=C(F)C=C2.Cl

Synonyms:

• Benzenemethanamine, N-[2-(1-cyclohexen-1-yl)ethyl]-4-fluoro-, hydrochloride (1:1)