
CAS 1048640-84-1
:1-Cyclohexene-1-ethanamine, N-propyl-, hydrochloride (1:1)
Description:
1-Cyclohexene-1-ethanamine, N-propyl-, hydrochloride (1:1) is a chemical compound characterized by its amine functional group and cyclohexene ring structure. As a hydrochloride salt, it is typically more stable and soluble in water compared to its free base form. The presence of the cyclohexene moiety suggests that the compound may exhibit unique reactivity due to the unsaturation in the ring, which can participate in various chemical reactions, including electrophilic additions. The N-propyl substituent indicates that the amine group is attached to a propyl chain, influencing its steric and electronic properties. This compound may be of interest in medicinal chemistry and organic synthesis, potentially serving as a building block for more complex molecules. Its hydrochloride form enhances its utility in biological applications, as it can improve solubility and bioavailability. Safety data and handling precautions should be observed, as with all amines and their salts, due to potential irritant properties.
Formula:C11H21N·ClH
InChI:InChI=1S/C11H21N.ClH/c1-2-9-12-10-8-11-6-4-3-5-7-11;/h6,12H,2-5,7-10H2,1H3;1H
InChI key:InChIKey=CRQXEJVKTTZBNY-UHFFFAOYSA-N
SMILES:C(CNCCC)C=1CCCCC1.Cl
Synonyms:- 1-Cyclohexene-1-ethanamine, N-propyl-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.