CAS 1048648-81-2

Methanone, (2-aminophenyl)-4-morpholinyl-, hydrochloride (1:1)

Description:

Methanone, (2-aminophenyl)-4-morpholinyl-, hydrochloride (1:1), also known by its CAS number 1048648-81-2, is a chemical compound characterized by its structural components that include a methanone group, an amino group attached to a phenyl ring, and a morpholine moiety. This compound typically exists as a hydrochloride salt, which enhances its solubility in water and may influence its pharmacological properties. The presence of the morpholine ring suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to interact with biological targets. The amino group can participate in hydrogen bonding, which may affect the compound's reactivity and interaction with other molecules. As a hydrochloride salt, it is likely to exhibit improved stability and bioavailability compared to its free base form. Overall, this compound's unique structure and properties make it of interest in various fields, including organic synthesis and drug development.

Formula: C₁₁H₁₄N₂O₂·ClH

InChI: InChI=1S/C11H14N2O2.ClH/c12-10-4-2-1-3-9(10)11(14)13-5-7-15-8-6-13;/h1-4H,5-8,12H2;1H

InChI key: InChIKey=BCTFRMAGTVLJGU-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(N)C=CC=C1)N2CCOCC2.Cl

Synonyms:

• Methanone, (2-aminophenyl)-4-morpholinyl-, hydrochloride (1:1)