CAS 1048648-82-3

Benzenepropanamine, 2-fluoro-β-phenyl-, hydrochloride (1:1)

Description:

Benzenepropanamine, 2-fluoro-β-phenyl-, hydrochloride (1:1) is a chemical compound characterized by its amine functional group and the presence of a fluorine atom on the propanamine chain. This compound features a benzene ring, which contributes to its aromatic properties, and the hydrochloride form indicates that it is a salt formed with hydrochloric acid, enhancing its solubility in water. The presence of the fluorine atom can influence the compound's reactivity, polarity, and biological activity, making it of interest in medicinal chemistry and drug development. Typically, such compounds may exhibit various pharmacological effects, potentially acting as neurotransmitter modulators or having applications in the treatment of certain medical conditions. The molecular structure and substituents play a crucial role in determining the compound's physical and chemical properties, including melting point, boiling point, and solubility. As with many amines, it may also exhibit basicity, allowing it to participate in acid-base reactions. Safety and handling precautions are essential due to potential toxicity and reactivity associated with amine compounds.

Formula: C₁₅H₁₆FN·ClH

InChI: InChI=1S/C15H16FN.ClH/c16-15-9-5-4-8-13(15)10-14(11-17)12-6-2-1-3-7-12;/h1-9,14H,10-11,17H2;1H

InChI key: InChIKey=CNLJTRCZTIEAST-UHFFFAOYSA-N

SMILES: C(CC1=C(F)C=CC=C1)(CN)C2=CC=CC=C2.Cl

Synonyms:

• Benzenepropanamine, 2-fluoro-β-phenyl-, hydrochloride (1:1)