CAS 1048664-15-8

Benzenamine, 5-chloro-2-(ethylthio)-, hydrochloride (1:1)

Description:

Benzenamine, 5-chloro-2-(ethylthio)-, hydrochloride (1:1) is an organic compound characterized by its amine functional group and the presence of a chloro substituent on the benzene ring. The ethylthio group introduces a sulfur atom into the structure, which can influence the compound's reactivity and solubility. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, including pharmaceuticals and chemical synthesis. The presence of the chlorine atom can impart specific electronic properties, affecting the compound's behavior in chemical reactions. This compound may exhibit biological activity, making it of interest in medicinal chemistry. Its molecular structure suggests potential interactions with biological targets, which could be explored in drug development. Safety data should be consulted for handling and usage, as compounds containing chlorine and sulfur can pose health risks. Overall, this compound represents a unique combination of functional groups that may lead to diverse chemical properties and applications.

Formula: C₈H₁₀ClNS·ClH

InChI: InChI=1S/C8H10ClNS.ClH/c1-2-11-8-4-3-6(9)5-7(8)10;/h3-5H,2,10H2,1H3;1H

InChI key: InChIKey=XGKFCRFZVDOTOG-UHFFFAOYSA-N

SMILES: S(CC)C1=C(N)C=C(Cl)C=C1.Cl

Synonyms:

• Benzenamine, 5-chloro-2-(ethylthio)-, hydrochloride (1:1)