CymitQuimica logo

CAS 1048673-59-1

:

1-Butanol, 2-[[(4-fluorophenyl)methyl]amino]-, hydrochloride (1:1)

Description:
1-Butanol, 2-[[[4-fluorophenyl)methyl]amino]-, hydrochloride (1:1) is a chemical compound characterized by its amine functional group and a butanol backbone. The presence of a 4-fluorophenyl group indicates that it has a fluorine atom substituted on the aromatic ring, which can influence its biological activity and solubility. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceuticals. The compound may exhibit properties such as moderate polarity due to the hydroxyl group and the amine, which can participate in hydrogen bonding. Its molecular structure suggests potential uses in medicinal chemistry, possibly as a precursor or intermediate in the synthesis of biologically active compounds. Additionally, the presence of the fluorine atom may impart unique electronic properties, potentially affecting the compound's reactivity and interaction with biological targets. Safety and handling precautions should be observed, as with any chemical substance, particularly in laboratory settings.
Formula:C11H16FNO·ClH
InChI:InChI=1S/C11H16FNO.ClH/c1-2-11(8-14)13-7-9-3-5-10(12)6-4-9;/h3-6,11,13-14H,2,7-8H2,1H3;1H
InChI key:InChIKey=VEVBQGAVPYMYHV-UHFFFAOYSA-N
SMILES:C(NC(CC)CO)C1=CC=C(F)C=C1.Cl
Synonyms:
  • 1-Butanol, 2-[[(4-fluorophenyl)methyl]amino]-, hydrochloride (1:1)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.