CAS 10487-96-4
:1-PHENYL-1-CYCLOPENTANOL
Description:
1-Phenyl-1-cyclopentanol, with the CAS number 10487-96-4, is an organic compound characterized by a cyclopentane ring bonded to a phenyl group and a hydroxyl (-OH) functional group. This compound typically appears as a colorless to pale yellow liquid or solid, depending on the temperature and purity. It is known for its moderate solubility in organic solvents and limited solubility in water due to the hydrophobic nature of the phenyl group. The presence of the hydroxyl group imparts some polar characteristics, allowing for hydrogen bonding. 1-Phenyl-1-cyclopentanol can participate in various chemical reactions, including oxidation and substitution, making it a useful intermediate in organic synthesis. Its structural features contribute to its potential applications in pharmaceuticals, agrochemicals, and materials science. Additionally, the compound's physical properties, such as boiling point and melting point, can vary based on the specific isomer and purity, influencing its behavior in different chemical environments.
Formula:C11H14O
InChI:InChI=1/C11H14O/c12-11(8-4-5-9-11)10-6-2-1-3-7-10/h1-3,6-7,12H,4-5,8-9H2
SMILES:c1ccc(cc1)C1(CCCC1)O
Synonyms:- 1-Phenyl-Cyclopentanol
- Nistc10487964
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1-Phenylcyclopentan-1-ol
CAS:1-Phenylcyclopentan-1-ol is an estrogenic compound that has been shown to be a potent contraceptive. It inhibits the production of estrogens, which are responsible for the development and maintenance of female reproductive tissues. 1-Phenylcyclopentan-1-ol also has anti-cancer activity, as it can inhibit the growth of cancer cells by inhibiting protein synthesis or cell division. This compound has been shown to have no effect on fertility in rats and rabbits. 1-Phenylcyclopentan-1-ol is also an alkoxy radical scavenger and can be used as a treatment for fatty acid peroxidation.
Formula:C11H14OPurity:Min. 95%Molecular weight:162.23 g/mol



