CAS 104870-56-6
:(+)-isopulegol
Description:
(+)-Isopulegol is a monoterpenoid alcohol characterized by its molecular formula C10H18O. It is a colorless to pale yellow liquid with a minty aroma, commonly found in essential oils, particularly in mint species. This compound exhibits a chiral center, resulting in its enantiomeric form, which contributes to its distinct sensory properties. (+)-Isopulegol is known for its potential applications in the fragrance and flavor industries, as well as in the formulation of various cosmetic products. Additionally, it has garnered interest in the field of medicinal chemistry due to its reported biological activities, including antimicrobial and anti-inflammatory properties. The compound is soluble in organic solvents and has a relatively low boiling point, making it volatile. Its stability and reactivity can be influenced by environmental factors, such as temperature and light. Overall, (+)-isopulegol is a versatile compound with significant relevance in both industrial applications and research contexts.
Formula:C5H3ClN4
InChI:InChI=1/C5H3ClN4/c6-5-9-2-3(1-7)4(8)10-5/h2H,(H2,8,9,10)
SMILES:C(#N)c1c[nH]c(Cl)nc1=N
Synonyms:- (+)-iso-Pulegol
- (1S,2R,5S)-5-methyl-2-(prop-1-en-2-yl)cyclohexanol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
(+)-Isopulegol
CAS:<p>(+)-Isopulegol is a monoterpenoid from Mentha canadensis L.</p>Formula:C10H18OPurity:99.885%Color and Shape:SolidMolecular weight:154.25(+)-Isopulegol
CAS:<p>(+)-Isopulegol is a naturally occurring ketone that exists as two enantiomers, (+)-isopulegol and (-)-isopulegol. It is the most abundant member of the terpene class of compounds in leaves. The two enantiomers are optically active and can be distinguished using techniques such as hydroxylamine analysis or eugenol synthesis. (+)-Isopulegol has been shown to have antioxidant properties, inhibiting lipid peroxidation and scavenging radicals, which may be due to its ability to inhibit cyclooxygenase enzymes.</p>Formula:C10H18OPurity:Min. 95%Molecular weight:154.25 g/mol


