CAS 1048703-18-9
:(3R)-3-(4-Fluorophenyl)pyrrolidine
Description:
(3R)-3-(4-Fluorophenyl)pyrrolidine is a chemical compound characterized by its pyrrolidine ring, which is a five-membered saturated heterocyclic structure containing one nitrogen atom. The compound features a 4-fluorophenyl group, indicating the presence of a fluorine atom attached to a phenyl ring at the para position relative to the nitrogen in the pyrrolidine. This substitution can influence the compound's pharmacological properties, including its potential as a ligand for various receptors. The stereochemistry of the compound is specified as (3R), indicating that the configuration at the chiral center is in the R form, which can significantly affect its biological activity and interactions. The compound may exhibit properties such as solubility in organic solvents and varying degrees of stability depending on environmental conditions. Its unique structure makes it of interest in medicinal chemistry, particularly in the development of pharmaceuticals targeting neurological or psychiatric conditions. As with many compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C10H12FN
InChI:InChI=1S/C10H12FN/c11-10-3-1-8(2-4-10)9-5-6-12-7-9/h1-4,9,12H,5-7H2/t9-/m0/s1
InChI key:InChIKey=IWOQWISAVOSATC-VIFPVBQESA-N
SMILES:FC1=CC=C(C=C1)[C@H]2CCNC2
Synonyms:- (3R)-3-(4-Fluorophenyl)pyrrolidine
- Pyrrolidine, 3-(4-fluorophenyl)-, (3R)-
- (R)-3-(4-Fluorophenyl)pyrrolidine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
(3R)-3-(4-Fluorophenyl)pyrrolidine
CAS:<p>(3R)-3-(4-Fluorophenyl)pyrrolidine</p>Molecular weight:165.20738g/mol(R)-3-(4-Fluorophenyl)pyrrolidine
CAS:Controlled Product<p>Applications (R)-3-(4-Fluorophenyl)pyrrolidine is a quinoline that is used as CRTH2 receptor modulators.<br>References Boyce, Christopher. et al.: Schering Corporation (2012);<br></p>Formula:C10H12FNColor and Shape:NeatMolecular weight:165.21


