CAS 104872-07-3
:3-Hexyl-4-(2-hydroxytridecyl)-2-oxetanone
Description:
3-Hexyl-4-(2-hydroxytridecyl)-2-oxetanone, with the CAS number 104872-07-3, is a chemical compound characterized by its oxetanone structure, which is a four-membered cyclic ester. This compound features a hexyl group and a hydroxytridecyl substituent, contributing to its unique properties. The presence of the hydroxy group suggests potential for hydrogen bonding, which may influence its solubility and reactivity. Generally, compounds like this can exhibit interesting physical properties, such as varying degrees of hydrophobicity and lipophilicity, depending on the length and branching of the alkyl chains. Additionally, the oxetanone moiety may impart specific reactivity, making it useful in various chemical applications, including polymer synthesis or as an intermediate in organic synthesis. The compound's stability, boiling point, and melting point would depend on its molecular interactions and the nature of its substituents. Overall, 3-Hexyl-4-(2-hydroxytridecyl)-2-oxetanone represents a class of compounds with potential utility in materials science and organic chemistry.
Formula:C22H42O3
InChI:InChI=1S/C22H42O3/c1-3-5-7-9-10-11-12-13-14-16-19(23)18-21-20(22(24)25-21)17-15-8-6-4-2/h19-21,23H,3-18H2,1-2H3
InChI key:InChIKey=RSOUWOFYULUWNE-UHFFFAOYSA-N
SMILES:C(C(CCCCCCCCCCC)O)C1C(CCCCCC)C(=O)O1
Synonyms:- 3-Hexyl-4-(2-hydroxytridecyl)-2-oxetanone
- 2-Oxetanone, 3-hexyl-4-(2-hydroxytridecyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.