CAS 104873-98-5
:(3S)-3-METHYL-1,4-BENZODIAZEPINE-2,5-DIONE
Description:
(3S)-3-Methyl-1,4-benzodiazepine-2,5-dione, identified by its CAS number 104873-98-5, is a chemical compound belonging to the benzodiazepine class, which is characterized by a fused benzene and diazepine ring structure. This compound features a methyl group at the 3-position and two carbonyl groups at the 2 and 5 positions of the diazepine ring, contributing to its unique chemical properties. It typically exhibits a solid state at room temperature and is soluble in organic solvents, but its solubility in water is limited. The stereochemistry at the 3-position is crucial for its biological activity, influencing its interaction with various receptors in the central nervous system. Benzodiazepines are known for their anxiolytic, sedative, and muscle relaxant properties, and compounds like (3S)-3-methyl-1,4-benzodiazepine-2,5-dione are often studied for their potential therapeutic applications. However, the specific pharmacological profile and safety of this compound would require further investigation through experimental studies.
Formula:C10H10N2O2
InChI:InChI=1/C10H10N2O2/c1-6-9(13)12-8-5-3-2-4-7(8)10(14)11-6/h2-6H,1H3,(H,11,14)(H,12,13)/t6-/m0/s1
SMILES:C[C@H]1C(=Nc2ccccc2C(=N1)O)O
Synonyms:- 1H-1,4-benzodiazepine-2,5-dione, 3,4-dihydro-3-methyl-, (3S)-
- (3S)-3-methyl-3,4-dihydro-1H-1,4-benzodiazepine-2,5-dione
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
3-Methyl-3,4-dihydro-1H-benzo[e][1,4]diazepine-2,5-dione
CAS:Formula:C10H10N2O2Molecular weight:190.1986
