CAS 104883-49-0
:3-Aminooctanoic acid
Description:
3-Aminooctanoic acid, also known as 3-amino-2-octanoic acid, is an amino acid characterized by its aliphatic chain and an amino group attached to the third carbon of an octanoic acid backbone. This compound features a carboxylic acid functional group (-COOH) at one end and an amino group (-NH2) at the third carbon, which contributes to its classification as an amino acid. It is a colorless to pale yellow solid that is soluble in water and exhibits properties typical of amino acids, such as the ability to participate in peptide bond formation. The presence of both hydrophilic (the amino and carboxylic groups) and hydrophobic (the long carbon chain) regions allows it to interact with various biological molecules, making it of interest in biochemical and pharmaceutical applications. Its CAS number, 104883-49-0, is a unique identifier that facilitates the tracking and study of this compound in scientific literature and databases. Overall, 3-aminooctanoic acid is significant in research related to protein synthesis and metabolic pathways.
Formula:C8H17NO2
InChI:InChI=1S/C8H17NO2/c1-2-3-4-5-7(9)6-8(10)11/h7H,2-6,9H2,1H3,(H,10,11)
InChI key:InChIKey=FYHHDJRMDOBZJF-UHFFFAOYSA-N
SMILES:C(C(CC(O)=O)N)CCCC
Synonyms:- RARECHEM AK ML 0071
- Caprylic acid, β-amino-
- 3-Aminooctanoic acid
- Octanoic acid, 3-amino-
- Octanoic acid, 3-amino-, (±)-
- 3-AMINO-OCTANOIC ACID
- DL-β-amino octanoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
