CAS 1048916-54-6
:2-(4-Bromophenyl)-2,3-dihydro-3-oxo-1H-isoindole-4-carboxylic acid
Description:
2-(4-Bromophenyl)-2,3-dihydro-3-oxo-1H-isoindole-4-carboxylic acid is a chemical compound characterized by its complex structure, which includes an isoindole core with a carboxylic acid functional group and a bromophenyl substituent. This compound typically exhibits properties associated with both aromatic and aliphatic systems due to its fused ring structure. The presence of the bromine atom enhances its reactivity and can influence its solubility and interaction with biological systems. The carboxylic acid group contributes to its acidity and potential for forming hydrogen bonds, which can affect its solubility in polar solvents. Additionally, the compound may exhibit biological activity, making it of interest in medicinal chemistry. Its molecular structure suggests potential applications in drug development, particularly in targeting specific biological pathways. Overall, the characteristics of this compound, including its reactivity, solubility, and biological potential, make it a subject of interest in both synthetic and medicinal chemistry research.
Formula:C15H10BrNO3
InChI:InChI=1S/C15H10BrNO3/c16-10-4-6-11(7-5-10)17-8-9-2-1-3-12(15(19)20)13(9)14(17)18/h1-7H,8H2,(H,19,20)
InChI key:InChIKey=RGKIQLTVILIMKM-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C2C(CN(C2=O)C3=CC=C(Br)C=C3)=CC=C1
Synonyms:- 1H-Isoindole-4-carboxylic acid, 2-(4-bromophenyl)-2,3-dihydro-3-oxo-
- 2-(4-Bromophenyl)-2,3-dihydro-3-oxo-1H-isoindole-4-carboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.