CAS 1048917-42-5

1-(5-Methyl-2-propoxyphenyl)ethanone

Description:

1-(5-Methyl-2-propoxyphenyl)ethanone, identified by its CAS number 1048917-42-5, is an organic compound characterized by its ketone functional group and a substituted aromatic ring. The structure features a phenyl group with a propoxy substituent and a methyl group at specific positions, contributing to its unique chemical properties. This compound is likely to exhibit moderate polarity due to the presence of the ketone and ether functionalities, influencing its solubility in various organic solvents. Its molecular structure suggests potential applications in organic synthesis, possibly as an intermediate in the production of pharmaceuticals or agrochemicals. Additionally, the presence of the methyl and propoxy groups may affect its reactivity and interaction with biological systems. As with many organic compounds, safety data should be consulted to understand its handling, storage, and potential hazards. Overall, 1-(5-Methyl-2-propoxyphenyl)ethanone represents a specific class of organic molecules with diverse applications in chemical research and industry.

Formula: C₁₂H₁₆O₂

InChI: InChI=1S/C12H16O2/c1-4-7-14-12-6-5-9(2)8-11(12)10(3)13/h5-6,8H,4,7H2,1-3H3

InChI key: InChIKey=YAUMQACGEFVNSF-UHFFFAOYSA-N

SMILES: O(CCC)C1=C(C(C)=O)C=C(C)C=C1

Synonyms:

• Ethanone, 1-(5-methyl-2-propoxyphenyl)-
• 1-(5-Methyl-2-propoxyphenyl)ethanone