
CAS 1048917-54-9
:1-[2-Methyl-4-(1-methylethoxy)phenyl]ethanone
Description:
1-[2-Methyl-4-(1-methylethoxy)phenyl]ethanone, with the CAS number 1048917-54-9, is an organic compound characterized by its ketone functional group and aromatic structure. This substance features a phenyl ring substituted with a methyl group and an ethoxy group, which contributes to its unique chemical properties. The presence of the ketone group indicates that it can participate in various chemical reactions, such as nucleophilic additions and reductions. Its molecular structure suggests potential applications in organic synthesis, particularly in the development of pharmaceuticals or agrochemicals. The compound's solubility, stability, and reactivity can be influenced by the substituents on the aromatic ring, which may affect its physical properties like boiling point and melting point. Additionally, the presence of the ethoxy group may enhance its lipophilicity, making it more soluble in organic solvents. As with many organic compounds, safety data should be consulted to understand its handling and potential hazards in laboratory or industrial settings.
Formula:C12H16O2
InChI:InChI=1S/C12H16O2/c1-8(2)14-11-5-6-12(10(4)13)9(3)7-11/h5-8H,1-4H3
InChI key:InChIKey=LYORXGGJDWDZGO-UHFFFAOYSA-N
SMILES:C(C)(=O)C1=C(C)C=C(OC(C)C)C=C1
Synonyms:- Ethanone, 1-[2-methyl-4-(1-methylethoxy)phenyl]-
- 1-[2-Methyl-4-(1-methylethoxy)phenyl]ethanone
- 1-[2-Methyl-4-(propan-2-yloxy)phenyl]ethan-1-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.