CAS 1048918-18-8

2-(3-Fluorophenyl)-4-methyl-1H-imidazole-5-carboxylic acid

Description:

2-(3-Fluorophenyl)-4-methyl-1H-imidazole-5-carboxylic acid is a chemical compound characterized by its imidazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms. The presence of a 3-fluorophenyl group indicates that a fluorine atom is substituted on the phenyl ring at the meta position, contributing to the compound's unique electronic properties. The methyl group at the 4-position of the imidazole ring adds to its hydrophobic character, while the carboxylic acid functional group at the 5-position introduces acidity and potential for hydrogen bonding. This compound may exhibit interesting biological activity due to its structural features, making it a candidate for pharmaceutical research. Its solubility, stability, and reactivity can be influenced by the functional groups present, and it may participate in various chemical reactions typical of carboxylic acids and heterocycles. Overall, this compound's characteristics make it a subject of interest in medicinal chemistry and material science.

Formula: C₁₁H₉FN₂O₂

InChI: InChI=1S/C11H9FN2O2/c1-6-9(11(15)16)14-10(13-6)7-3-2-4-8(12)5-7/h2-5H,1H3,(H,13,14)(H,15,16)

InChI key: InChIKey=KXNDWARHJYIGKB-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1NC(=NC1C)C2=CC(F)=CC=C2

Synonyms:

• 1H-Imidazole-5-carboxylic acid, 2-(3-fluorophenyl)-4-methyl-
• 2-(3-Fluorophenyl)-4-methyl-1H-imidazole-5-carboxylic acid