CymitQuimica logo

CAS 1048918-49-5

:

4-(Chloromethyl)-2-(2,4-dimethoxyphenyl)-5-methyloxazole

Description:
4-(Chloromethyl)-2-(2,4-dimethoxyphenyl)-5-methyloxazole, identified by its CAS number 1048918-49-5, is a chemical compound that features a unique oxazole ring structure, which is a five-membered heterocyclic compound containing both nitrogen and oxygen. This substance is characterized by the presence of a chloromethyl group, which enhances its reactivity and potential for further chemical modifications. The dimethoxyphenyl substituent contributes to its aromatic properties and may influence its solubility and interaction with biological systems. The methyl group on the oxazole ring can affect the compound's electronic properties and steric hindrance. Overall, this compound may exhibit interesting pharmacological activities due to its structural features, making it a candidate for further research in medicinal chemistry. Its synthesis and characterization would typically involve standard organic reactions, and its properties can be explored through various analytical techniques such as NMR, IR spectroscopy, and mass spectrometry.
Formula:C13H14ClNO3
InChI:InChI=1S/C13H14ClNO3/c1-8-11(7-14)15-13(18-8)10-5-4-9(16-2)6-12(10)17-3/h4-6H,7H2,1-3H3
InChI key:InChIKey=YXOAUKGFLSUASV-UHFFFAOYSA-N
SMILES:O(C)C1=C(C=CC(OC)=C1)C2=NC(CCl)=C(C)O2
Synonyms:
  • Oxazole, 4-(chloromethyl)-2-(2,4-dimethoxyphenyl)-5-methyl-
  • 4-(Chloromethyl)-2-(2,4-dimethoxyphenyl)-5-methyloxazole
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.