CymitQuimica logo

CAS 1048921-26-1

:

4-[[2-(2,5-Dimethoxyphenyl)-5-methyl-4-oxazolyl]methoxy]benzaldehyde

Description:
4-[[2-(2,5-Dimethoxyphenyl)-5-methyl-4-oxazolyl]methoxy]benzaldehyde is a synthetic organic compound characterized by its complex structure, which includes a benzaldehyde moiety and an oxazole ring. This compound features multiple functional groups, including methoxy groups, which contribute to its chemical reactivity and potential applications in medicinal chemistry. The presence of the oxazole ring suggests potential biological activity, as heterocycles are often found in pharmaceuticals. The dimethoxyphenyl group may enhance lipophilicity, influencing the compound's solubility and permeability. Additionally, the methyl substitution on the oxazole ring can affect the compound's electronic properties and steric hindrance. Overall, this compound's unique structural features may make it of interest for research in drug development, particularly in the exploration of new therapeutic agents. However, specific properties such as melting point, boiling point, and solubility would require empirical data for a comprehensive understanding of its behavior in various chemical environments.
Formula:C20H19NO5
InChI:InChI=1S/C20H19NO5/c1-13-18(12-25-15-6-4-14(11-22)5-7-15)21-20(26-13)17-10-16(23-2)8-9-19(17)24-3/h4-11H,12H2,1-3H3
InChI key:InChIKey=NZNKQJVRJMUKHE-UHFFFAOYSA-N
SMILES:O(C)C1=C(C=C(OC)C=C1)C2=NC(COC3=CC=C(C=O)C=C3)=C(C)O2
Synonyms:
  • Benzaldehyde, 4-[[2-(2,5-dimethoxyphenyl)-5-methyl-4-oxazolyl]methoxy]-
  • 4-[[2-(2,5-Dimethoxyphenyl)-5-methyl-4-oxazolyl]methoxy]benzaldehyde
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.