CAS 1048922-57-1: 3-(2-Aminoethyl)-5-[(3-chlorophenyl)methyl]-2,4-oxazolidinedione

Description:3-(2-Aminoethyl)-5-[(3-chlorophenyl)methyl]-2,4-oxazolidinedione, identified by its CAS number 1048922-57-1, is a chemical compound that belongs to the oxazolidinedione class. This substance features a five-membered heterocyclic ring containing both oxygen and nitrogen atoms, which contributes to its unique chemical properties. The presence of the 3-chlorophenylmethyl group indicates that it has a chlorinated aromatic moiety, which can influence its biological activity and interactions. The aminoethyl side chain suggests potential for hydrogen bonding and reactivity, making it of interest in medicinal chemistry. Oxazolidinediones are often studied for their pharmacological properties, including potential antimicrobial and anti-inflammatory effects. The compound's structure may allow it to interact with various biological targets, making it a candidate for further research in drug development. As with many chemical substances, its stability, solubility, and reactivity would depend on environmental conditions and the presence of other chemical species.

Formula:C₁₂H₁₃ClN₂O₃

InChI:InChI=1S/C12H13ClN2O3/c13-9-3-1-2-8(6-9)7-10-11(16)15(5-4-14)12(17)18-10/h1-3,6,10H,4-5,7,14H2

InChI key:InChIKey=MPIMDVJJNDUJPU-UHFFFAOYSA-N

SMILES:O=C1OC(C(=O)N1CCN)CC=2C=CC=C(Cl)C2