CAS 1048948-07-7

Benzenemethanamine, 3-methoxy-N-propyl-, hydrochloride (1:1)

Description:

Benzenemethanamine, 3-methoxy-N-propyl-, hydrochloride (1:1), also known by its CAS number 1048948-07-7, is a chemical compound characterized by its amine functional group and a methoxy substituent on the benzene ring. This compound typically appears as a white to off-white crystalline solid and is soluble in water due to the presence of the hydrochloride salt form, which enhances its solubility compared to the free base. The presence of the propyl group contributes to its hydrophobic characteristics, while the methoxy group can influence its electronic properties and reactivity. This compound may be of interest in pharmaceutical research and development, particularly in the context of drug design, as it may exhibit biological activity related to its structural features. As with many amines, it may participate in various chemical reactions, including alkylation and acylation, and can serve as a building block for more complex organic molecules. Proper handling and storage are essential due to potential reactivity and safety considerations associated with amines and their derivatives.

Formula: C₁₁H₁₇NO·ClH

InChI: InChI=1S/C11H17NO.ClH/c1-3-7-12-9-10-5-4-6-11(8-10)13-2;/h4-6,8,12H,3,7,9H2,1-2H3;1H

InChI key: InChIKey=BTNIJWRWLWVUFG-UHFFFAOYSA-N

SMILES: C(NCCC)C1=CC(OC)=CC=C1.Cl

Synonyms:

• Benzenemethanamine, 3-methoxy-N-propyl-, hydrochloride (1:1)

N-(3-methoxybenzyl)-1-propanamine hydrochloride

CAS: 1048948-07-7

Formula: C₁₁H₁₈ClNO

Purity: 95.0%

Molecular weight: 215.72

Ref: 10-F361639