
CAS 1048948-08-8
:Benzenemethanamine, 3-ethoxy-N-propyl-, hydrochloride (1:1)
Description:
Benzenemethanamine, 3-ethoxy-N-propyl-, hydrochloride (1:1) is a chemical compound characterized by its amine functional group and aromatic benzene ring. It features a propyl chain and an ethoxy group, which contribute to its hydrophobic properties, while the hydrochloride form indicates that it is a salt, enhancing its solubility in water. This compound is likely to exhibit basic properties due to the presence of the amine group, which can accept protons. The molecular structure suggests potential applications in pharmaceuticals or as a building block in organic synthesis. Its hydrochloride form may also influence its stability and reactivity, making it suitable for various chemical reactions. Safety data and handling precautions should be considered, as with any chemical substance, particularly regarding its potential toxicity and environmental impact. Overall, the compound's unique structure and properties make it of interest in both research and industrial applications.
Formula:C12H19NO·ClH
InChI:InChI=1S/C12H19NO.ClH/c1-3-8-13-10-11-6-5-7-12(9-11)14-4-2;/h5-7,9,13H,3-4,8,10H2,1-2H3;1H
InChI key:InChIKey=CEWSVSPTSHCZHN-UHFFFAOYSA-N
SMILES:C(NCCC)C1=CC(OCC)=CC=C1.Cl
Synonyms:- Benzenemethanamine, 3-ethoxy-N-propyl-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.