
CAS 1048960-63-9
:4-(3-Thienyl)-3-pyridinamine
Description:
4-(3-Thienyl)-3-pyridinamine is an organic compound characterized by its unique structure, which includes a pyridine ring and a thienyl group. The presence of both nitrogen and sulfur in its molecular framework contributes to its potential reactivity and biological activity. This compound typically exhibits properties associated with heterocyclic amines, such as moderate solubility in polar solvents and potential interactions with biological targets due to its ability to form hydrogen bonds. Its molecular structure suggests that it may participate in various chemical reactions, including electrophilic substitutions and nucleophilic attacks, making it of interest in medicinal chemistry and material science. Additionally, the thienyl group can enhance the compound's electronic properties, potentially influencing its behavior in electronic applications or as a ligand in coordination chemistry. Overall, 4-(3-Thienyl)-3-pyridinamine represents a versatile building block for further chemical synthesis and exploration in various fields, including pharmaceuticals and agrochemicals.
Formula:C9H8N2S
InChI:InChI=1S/C9H8N2S/c10-9-5-11-3-1-8(9)7-2-4-12-6-7/h1-6H,10H2
InChI key:InChIKey=GZEUXMUETLVMJJ-UHFFFAOYSA-N
SMILES:NC=1C(C=2C=CSC2)=CC=NC1
Synonyms:- 4-(3-Thienyl)-3-pyridinamine
- 3-Pyridinamine, 4-(3-thienyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.