CAS 1048971-80-7
:N-(4-Bromo-2-methylphenyl)-5-oxo-2-pyrrolidinecarboxamide
Description:
N-(4-Bromo-2-methylphenyl)-5-oxo-2-pyrrolidinecarboxamide, with the CAS number 1048971-80-7, is a chemical compound characterized by its unique structural features. It contains a pyrrolidine ring, which is a five-membered cyclic amine, and a carboxamide functional group, indicating the presence of an amide bond. The compound also features a 4-bromo-2-methylphenyl substituent, which contributes to its aromatic properties and may influence its reactivity and biological activity. The presence of the 5-oxo group suggests that it may exhibit keto-enol tautomerism, potentially affecting its stability and interactions. This compound may be of interest in medicinal chemistry due to its structural motifs, which are often associated with biological activity. Its solubility, melting point, and other physical properties would depend on the specific conditions and solvent used. Overall, the characteristics of this compound make it a candidate for further investigation in various chemical and pharmaceutical applications.
Formula:C12H13BrN2O2
InChI:InChI=1S/C12H13BrN2O2/c1-7-6-8(13)2-3-9(7)15-12(17)10-4-5-11(16)14-10/h2-3,6,10H,4-5H2,1H3,(H,14,16)(H,15,17)
InChI key:InChIKey=SJPFQLCOFGCKOY-UHFFFAOYSA-N
SMILES:N(C(=O)C1NC(=O)CC1)C2=C(C)C=C(Br)C=C2
Synonyms:- N-(4-Bromo-2-methylphenyl)-5-oxo-2-pyrrolidinecarboxamide
- 2-Pyrrolidinecarboxamide, N-(4-bromo-2-methylphenyl)-5-oxo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.