CymitQuimica logo

CAS 1048971-81-8

:

N-(4-Chloro-2-methylphenyl)-5-oxo-2-pyrrolidinecarboxamide

Description:
N-(4-Chloro-2-methylphenyl)-5-oxo-2-pyrrolidinecarboxamide is a chemical compound characterized by its unique structure, which includes a pyrrolidine ring and a carboxamide functional group. The presence of a chloro substituent on the aromatic ring contributes to its potential biological activity, while the 5-oxo group indicates the presence of a carbonyl functionality, which can influence the compound's reactivity and interactions. This compound may exhibit properties typical of amides, such as hydrogen bonding capabilities, which can affect its solubility and stability in various solvents. Additionally, the specific arrangement of substituents can impact its pharmacological profile, making it of interest in medicinal chemistry. The compound's molecular structure suggests potential applications in drug development, particularly in targeting specific biological pathways. However, detailed studies would be necessary to fully understand its properties, including its synthesis, reactivity, and biological effects. As with many chemical substances, safety and handling precautions should be observed due to the presence of chlorine and other reactive groups.
Formula:C12H13ClN2O2
InChI:InChI=1S/C12H13ClN2O2/c1-7-6-8(13)2-3-9(7)15-12(17)10-4-5-11(16)14-10/h2-3,6,10H,4-5H2,1H3,(H,14,16)(H,15,17)
InChI key:InChIKey=XDCNCGUHLWFRFB-UHFFFAOYSA-N
SMILES:N(C(=O)C1NC(=O)CC1)C2=C(C)C=C(Cl)C=C2
Synonyms:
  • 2-Pyrrolidinecarboxamide, N-(4-chloro-2-methylphenyl)-5-oxo-
  • N-(4-Chloro-2-methylphenyl)-5-oxo-2-pyrrolidinecarboxamide
  • N-(4-CHLORO-2-METHYLPHENYL)-5-OXOPROLINAMIDE
  • N-(4-chloro-2-methylphenyl)-5-oxopyrrolidine-2-carboxamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.