CymitQuimica logo

CAS 1048976-83-5

:

Pyridine, 1,2,3,6-tetrahydro-1-(phenylmethyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-

Description:
Pyridine, 1,2,3,6-tetrahydro-1-(phenylmethyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-, identified by CAS number 1048976-83-5, is a complex organic compound featuring a pyridine ring that has been saturated at specific positions, resulting in a tetrahydro structure. This compound incorporates a phenylmethyl group, which contributes to its aromatic characteristics, and a dioxaborolane moiety, which is notable for its boron content and potential reactivity in various chemical transformations. The presence of the dioxaborolane group suggests applications in organoboron chemistry, particularly in cross-coupling reactions and as a potential reagent in organic synthesis. The compound's structure indicates it may exhibit unique physical and chemical properties, such as solubility in organic solvents and potential interactions with nucleophiles or electrophiles due to the boron atom. Overall, this compound represents a specialized class of pyridine derivatives with potential utility in medicinal chemistry and materials science.
Formula:C18H26BNO2
InChI:InChI=1S/C18H26BNO2/c1-17(2)18(3,4)22-19(21-17)16-10-12-20(13-11-16)14-15-8-6-5-7-9-15/h5-10H,11-14H2,1-4H3
InChI key:SBZWAVVCJBBNSM-UHFFFAOYSA-N
SMILES:B1(OC(C(O1)(C)C)(C)C)C2=CCN(CC2)CC3=CC=CC=C3
Synonyms:
  • 1,2,3,6-Tetrahydro-1-(phenylmethyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine
  • 1-Benzyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,2,3,6-tetrahydropyridine
Found 5 products.